C17H17ClN2O4S — CID 113076649
1-(1,3-benzodioxol-5-ylsulfonyl)-4-(2-chlorophenyl)piperazine (PubChem CID 113076649) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(2-chlorophenyl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(2-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 113076649 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(2-chlorophenyl)piperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H17ClN2O4S/c18-14-3-1-2-4-15(14)19-7-9-20(10-8-19)25(21,22)13-5-6-16-17(11-13)24-12-23-16/h1-6,11H,7-10,12H2 |
| InChIKey | QMPOVZHFDXUPBA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |