C19H22N2O4S — CID 113074042
1-(1,3-benzodioxol-5-ylsulfonyl)-4-(1-phenylethyl)piperazine (PubChem CID 113074042) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(1-phenylethyl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(1-phenylethyl)piperazine |
|---|---|
| PubChem CID | 113074042 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(1-phenylethyl)piperazine |
| SMILES | CC(c1ccccc1)N1CCN(S(=O)(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H22N2O4S/c1-15(16-5-3-2-4-6-16)20-9-11-21(12-10-20)26(22,23)17-7-8-18-19(13-17)25-14-24-18/h2-8,13,15H,9-12,14H2,1H3 |
| InChIKey | BLIWNTQGRHDZFA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |