C18H20N2O4S — CID 110658063
4-(1,3-benzodioxol-5-ylsulfonyl)-2-methyl-1-phenylpiperazine (PubChem CID 110658063) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylsulfonyl)-2-methyl-1-phenylpiperazine.
| Compound Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-2-methyl-1-phenylpiperazine |
|---|---|
| PubChem CID | 110658063 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-2-methyl-1-phenylpiperazine |
| SMILES | CC1CN(S(=O)(=O)c2ccc3c(c2)OCO3)CCN1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-14-12-19(9-10-20(14)15-5-3-2-4-6-15)25(21,22)16-7-8-17-18(11-16)24-13-23-17/h2-8,11,14H,9-10,12-13H2,1H3 |
| InChIKey | AFXCMXWIYHCTBE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |