C20H23ClN2O5S — CID 16884222
1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-4-(2-chlorophenyl)piperazine (PubChem CID 16884222) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-4-(2-chlorophenyl)piperazine.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-4-(2-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 16884222 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-4-(2-chlorophenyl)piperazine |
| SMILES | O=S(=O)(CCCOc1ccc2c(c1)OCO2)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H23ClN2O5S/c21-17-4-1-2-5-18(17)22-8-10-23(11-9-22)29(24,25)13-3-12-26-16-6-7-19-20(14-16)28-15-27-19/h1-2,4-7,14H,3,8-13,15H2 |
| InChIKey | UYAQWCBEXHKRCG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|