C15H20N2O6S — CID 16884285
4-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]piperazine-1-carbaldehyde (PubChem CID 16884285) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 16884285 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(S(=O)(=O)CCCOc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H20N2O6S/c18-11-16-4-6-17(7-5-16)24(19,20)9-1-8-21-13-2-3-14-15(10-13)23-12-22-14/h2-3,10-11H,1,4-9,12H2 |
| InChIKey | PWLSGPAPISZPKH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|