C16H21NO5S — CID 16884291
3-(1,3-benzodioxol-5-yloxy)-N,N-bis(prop-2-enyl)propane-1-sulfonamide (PubChem CID 16884291) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)-N,N-bis(prop-2-enyl)propane-1-sulfonamide.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)-N,N-bis(prop-2-enyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 16884291 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)-N,N-bis(prop-2-enyl)propane-1-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H21NO5S/c1-3-8-17(9-4-2)23(18,19)11-5-10-20-14-6-7-15-16(12-14)22-13-21-15/h3-4,6-7,12H,1-2,5,8-11,13H2 |
| InChIKey | ALZZVGKTCQEWQW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|