C10H11O6S- — CID 20593635
3-(1,3-benzodioxol-5-yloxy)propane-1-sulfonate (PubChem CID 20593635) has the molecular formula C10H11O6S- and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)propane-1-sulfonate.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 20593635 |
| Molecular Formula | C10H11O6S- |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12O6S/c11-17(12,13)5-1-4-14-8-2-3-9-10(6-8)16-7-15-9/h2-3,6H,1,4-5,7H2,(H,11,12,13)/p-1 |
| InChIKey | UOONKQWWFQMMBW-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|