C16H23NO5S — CID 16884211
1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-3-methylpiperidine (PubChem CID 16884211) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-3-methylpiperidine.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 16884211 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yloxy)propylsulfonyl]-3-methylpiperidine |
| SMILES | CC1CCCN(S(=O)(=O)CCCOc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C16H23NO5S/c1-13-4-2-7-17(11-13)23(18,19)9-3-8-20-14-5-6-15-16(10-14)22-12-21-15/h5-6,10,13H,2-4,7-9,11-12H2,1H3 |
| InChIKey | HVGFWYQGOVAKNI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|