C17H25NO3 — CID 52771462
(2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]-2-ethylpiperidine (PubChem CID 52771462) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]-2-ethylpiperidine.
| Compound Name | (2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]-2-ethylpiperidine |
|---|---|
| PubChem CID | 52771462 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]-2-ethylpiperidine |
| SMILES | CC[C@H]1CCCCN1CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H25NO3/c1-2-14-6-3-4-9-18(14)10-5-11-19-15-7-8-16-17(12-15)21-13-20-16/h7-8,12,14H,2-6,9-11,13H2,1H3/t14-/m0/s1 |
| InChIKey | JUOFFHIJXCKYCS-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|