C20H27N3O4 — CID 99780536
(1R)-2-[(2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol (PubChem CID 99780536) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is (1R)-2-[(2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | (1R)-2-[(2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 99780536 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (1R)-2-[(2S)-1-[3-(1,3-benzodioxol-5-yloxy)propyl]pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc([C@H](O)C[C@@H]2CCCN2CCCOc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C20H27N3O4/c1-22-13-15(12-21-22)18(24)10-16-4-2-7-23(16)8-3-9-25-17-5-6-19-20(11-17)27-14-26-19/h5-6,11-13,16,18,24H,2-4,7-10,14H2,1H3/t16-,18+/m0/s1 |
| InChIKey | WBAZDTMGZCQTLE-FUHWJXTLSA-N |
| XLogP | 2.51 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|