C14H19N3O4S — CID 124728531
(1S)-2-[(2R)-1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol (PubChem CID 124728531) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is (1S)-2-[(2R)-1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | (1S)-2-[(2R)-1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 124728531 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (1S)-2-[(2R)-1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc([C@@H](O)C[C@H]2CCCN2S(=O)(=O)c2ccco2)cn1 |
| InChI | InChI=1S/C14H19N3O4S/c1-16-10-11(9-15-16)13(18)8-12-4-2-6-17(12)22(19,20)14-5-3-7-21-14/h3,5,7,9-10,12-13,18H,2,4,6,8H2,1H3/t12-,13+/m1/s1 |
| InChIKey | DZXLGBIRKZAIEQ-OLZOCXBDSA-N |
| XLogP | 1.29 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |