C9H15ClN2O3S — CID 120875357
[1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 120875357) has the molecular formula C9H15ClN2O3S and a molecular weight of 266.75 g/mol. Its IUPAC name is [1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120875357 |
| Molecular Formula | C9H15ClN2O3S |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | [1-(furan-2-ylsulfonyl)pyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN1S(=O)(=O)c1ccco1 |
| InChI | InChI=1S/C9H14N2O3S.ClH/c10-7-8-3-1-5-11(8)15(12,13)9-4-2-6-14-9;/h2,4,6,8H,1,3,5,7,10H2;1H |
| InChIKey | GMVUPMKRDXLDSI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |