C10H17ClN2O3S — CID 120874730
[1-(furan-2-ylsulfonyl)piperidin-2-yl]methanamine;hydrochloride (PubChem CID 120874730) has the molecular formula C10H17ClN2O3S and a molecular weight of 280.78 g/mol. Its IUPAC name is [1-(furan-2-ylsulfonyl)piperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(furan-2-ylsulfonyl)piperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120874730 |
| Molecular Formula | C10H17ClN2O3S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [1-(furan-2-ylsulfonyl)piperidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCCN1S(=O)(=O)c1ccco1 |
| InChI | InChI=1S/C10H16N2O3S.ClH/c11-8-9-4-1-2-6-12(9)16(13,14)10-5-3-7-15-10;/h3,5,7,9H,1-2,4,6,8,11H2;1H |
| InChIKey | VWGNDSKXINCKHX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |