C12H16ClF3N2O2S — CID 119969346
[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride (PubChem CID 119969346) has the molecular formula C12H16ClF3N2O2S and a molecular weight of 344.79 g/mol. Its IUPAC name is [1-(2,4,5-trifluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(2,4,5-trifluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119969346 |
| Molecular Formula | C12H16ClF3N2O2S |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [1-(2,4,5-trifluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCCN1S(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O2S.ClH/c13-9-5-11(15)12(6-10(9)14)20(18,19)17-4-2-1-3-8(17)7-16;/h5-6,8H,1-4,7,16H2;1H |
| InChIKey | GPAXPBJDQVUKGE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|