C12H16Cl3FN2O2S — CID 120708048
[1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride (PubChem CID 120708048) has the molecular formula C12H16Cl3FN2O2S and a molecular weight of 377.70 g/mol. Its IUPAC name is [1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120708048 |
| Molecular Formula | C12H16Cl3FN2O2S |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCCN1S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H15Cl2FN2O2S.ClH/c13-9-4-5-10(11(14)12(9)15)20(18,19)17-6-2-1-3-8(17)7-16;/h4-5,8H,1-3,6-7,16H2;1H |
| InChIKey | WDDVOYSRWRIORF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|