C11H13ClFNO3S — CID 66260781
[(2R)-1-(3-chloro-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 66260781) has the molecular formula C11H13ClFNO3S and a molecular weight of 293.75 g/mol. Its IUPAC name is [(2R)-1-(3-chloro-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-(3-chloro-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 66260781 |
| Molecular Formula | C11H13ClFNO3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | [(2R)-1-(3-chloro-2-fluorophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cccc(Cl)c1F)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C11H13ClFNO3S/c12-9-4-1-5-10(11(9)13)18(16,17)14-6-2-3-8(14)7-15/h1,4-5,8,15H,2-3,6-7H2/t8-/m1/s1 |
| InChIKey | PUSVAGGUDYXMTF-MRVPVSSYSA-N |
| XLogP | 1.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |