C11H14Cl2N2O3S — CID 107212258
[(2R)-1-(3-amino-2,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 107212258) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is [(2R)-1-(3-amino-2,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-(3-amino-2,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 107212258 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | [(2R)-1-(3-amino-2,4-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Nc1c(Cl)ccc(S(=O)(=O)N2CCC[C@@H]2CO)c1Cl |
| InChI | InChI=1S/C11H14Cl2N2O3S/c12-8-3-4-9(10(13)11(8)14)19(17,18)15-5-1-2-7(15)6-16/h3-4,7,16H,1-2,5-6,14H2/t7-/m1/s1 |
| InChIKey | XMAWKHXPXNABOZ-SSDOTTSWSA-N |
| XLogP | 1.72 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|