C13H17ClN2O3S2 — CID 80695525
4-chloro-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzenecarbothioamide (PubChem CID 80695525) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 4-chloro-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzenecarbothioamide.
| Compound Name | 4-chloro-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzenecarbothioamide |
|---|---|
| PubChem CID | 80695525 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-chloro-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2CO)c1 |
| InChI | InChI=1S/C13H17ClN2O3S2/c14-11-5-4-9(13(15)20)7-12(11)21(18,19)16-6-2-1-3-10(16)8-17/h4-5,7,10,17H,1-3,6,8H2,(H2,15,20) |
| InChIKey | VXCYEMZZEBPVCY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|