C15H20ClNO4S — CID 85496512
methyl 4-chloro-3-(2-ethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 85496512) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is methyl 4-chloro-3-(2-ethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 4-chloro-3-(2-ethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 85496512 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | methyl 4-chloro-3-(2-ethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CCC1CCCCN1S(=O)(=O)c1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C15H20ClNO4S/c1-3-12-6-4-5-9-17(12)22(19,20)14-10-11(15(18)21-2)7-8-13(14)16/h7-8,10,12H,3-6,9H2,1-2H3 |
| InChIKey | MGFVEEBITXHKRS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |