C21H22ClNO6S — CID 3979318
(4-methoxycarbonylphenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 3979318) has the molecular formula C21H22ClNO6S and a molecular weight of 451.93 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (4-methoxycarbonylphenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3979318 |
| Molecular Formula | C21H22ClNO6S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(COC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H22ClNO6S/c1-28-20(24)16-7-5-15(6-8-16)14-29-21(25)17-9-10-18(22)19(13-17)30(26,27)23-11-3-2-4-12-23/h5-10,13H,2-4,11-12,14H2,1H3 |
| InChIKey | OTVLOTIOWBADDJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |