C20H19ClN2O4S — CID 2673251
(4-cyanophenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2673251) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (4-cyanophenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2673251 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (4-cyanophenyl)methyl 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | N#Cc1ccc(COC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H19ClN2O4S/c21-18-9-8-17(12-19(18)28(25,26)23-10-2-1-3-11-23)20(24)27-14-16-6-4-15(13-22)5-7-16/h4-9,12H,1-3,10-11,14H2 |
| InChIKey | VQOIHRLRTXHQQM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |