C19H20ClNO5S — CID 2513690
2-phenoxyethyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2513690) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is 2-phenoxyethyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | 2-phenoxyethyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2513690 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-phenoxyethyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCCOc1ccccc1)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H20ClNO5S/c20-17-9-8-15(14-18(17)27(23,24)21-10-4-5-11-21)19(22)26-13-12-25-16-6-2-1-3-7-16/h1-3,6-9,14H,4-5,10-13H2 |
| InChIKey | YAKPSUSHZSEEFE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|