C17H18ClNO6S — CID 8722281
2-phenoxyethyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8722281) has the molecular formula C17H18ClNO6S and a molecular weight of 399.85 g/mol. Its IUPAC name is 2-phenoxyethyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | 2-phenoxyethyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8722281 |
| Molecular Formula | C17H18ClNO6S |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-phenoxyethyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)OCCOc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C17H18ClNO6S/c1-19(23-2)26(21,22)16-12-13(8-9-15(16)18)17(20)25-11-10-24-14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | CDGFSKNUMLWHKE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|