C23H20ClNO6S — CID 46825504
(2-oxo-1,2-diphenylethyl) 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 46825504) has the molecular formula C23H20ClNO6S and a molecular weight of 473.93 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46825504 |
| Molecular Formula | C23H20ClNO6S |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C23H20ClNO6S/c1-25(30-2)32(28,29)20-15-18(13-14-19(20)24)23(27)31-22(17-11-7-4-8-12-17)21(26)16-9-5-3-6-10-16/h3-15,22H,1-2H3 |
| InChIKey | WQCKLLUWRCQBQM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|