C13H16ClNO6S — CID 8722317
[(2S)-3-oxobutan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8722317) has the molecular formula C13H16ClNO6S and a molecular weight of 349.79 g/mol. Its IUPAC name is [(2S)-3-oxobutan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-3-oxobutan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8722317 |
| Molecular Formula | C13H16ClNO6S |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | [(2S)-3-oxobutan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)O[C@@H](C)C(C)=O)ccc1Cl |
| InChI | InChI=1S/C13H16ClNO6S/c1-8(16)9(2)21-13(17)10-5-6-11(14)12(7-10)22(18,19)15(3)20-4/h5-7,9H,1-4H3/t9-/m0/s1 |
| InChIKey | IPAKMDAYOONYRA-VIFPVBQESA-N |
| XLogP | 1.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|