C25H23ClN2O8S — CID 98383221
[(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 98383221) has the molecular formula C25H23ClN2O8S and a molecular weight of 546.99 g/mol. Its IUPAC name is [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 98383221 |
| Molecular Formula | C25H23ClN2O8S |
| Molecular Weight | 546.99 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)OC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)OC)c1)oc1ccccc12 |
| InChI | InChI=1S/C25H23ClN2O8S/c1-14(35-25(30)15-9-10-18(26)23(11-15)37(31,32)28(2)34-4)24(29)27-19-13-21-17(12-22(19)33-3)16-7-5-6-8-20(16)36-21/h5-14H,1-4H3,(H,27,29)/t14-/m0/s1 |
| InChIKey | NPMDKVYMZNPSPY-AWEZNQCLSA-N |
| XLogP | 4.61 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.99 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|