C25H24N2O5 — CID 41152870
[(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-(dimethylamino)benzoate (PubChem CID 41152870) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-(dimethylamino)benzoate.
| Compound Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 41152870 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-(dimethylamino)benzoate |
| SMILES | COc1cc2c(cc1NC(=O)[C@@H](C)OC(=O)c1ccc(N(C)C)cc1)oc1ccccc12 |
| InChI | InChI=1S/C25H24N2O5/c1-15(31-25(29)16-9-11-17(12-10-16)27(2)3)24(28)26-20-14-22-19(13-23(20)30-4)18-7-5-6-8-21(18)32-22/h5-15H,1-4H3,(H,26,28)/t15-/m1/s1 |
| InChIKey | GGPHKGTVASSPSE-OAHLLOKOSA-N |
| XLogP | 4.84 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |