C23H18ClNO5 — CID 4802218
[1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate (PubChem CID 4802218) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate.
| Compound Name | [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4802218 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate |
| SMILES | COc1cc2c(cc1NC(=O)C(C)OC(=O)c1ccccc1Cl)oc1ccccc12 |
| InChI | InChI=1S/C23H18ClNO5/c1-13(29-23(27)15-8-3-5-9-17(15)24)22(26)25-18-12-20-16(11-21(18)28-2)14-7-4-6-10-19(14)30-20/h3-13H,1-2H3,(H,25,26) |
| InChIKey | JKDTUVCGTZEBOQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |