C22H18N2O5 — CID 7783804
[(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] pyridine-4-carboxylate (PubChem CID 7783804) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] pyridine-4-carboxylate.
| Compound Name | [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7783804 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] pyridine-4-carboxylate |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)OC(=O)c1ccncc1)oc1ccccc12 |
| InChI | InChI=1S/C22H18N2O5/c1-13(28-22(26)14-7-9-23-10-8-14)21(25)24-17-12-19-16(11-20(17)27-2)15-5-3-4-6-18(15)29-19/h3-13H,1-2H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | TXQGSQBNYAEMBO-ZDUSSCGKSA-N |
| XLogP | 4.17 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |