C23H20N2O5 — CID 7890835
[(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-aminobenzoate (PubChem CID 7890835) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-aminobenzoate.
| Compound Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 7890835 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 4-aminobenzoate |
| SMILES | COc1cc2c(cc1NC(=O)[C@@H](C)OC(=O)c1ccc(N)cc1)oc1ccccc12 |
| InChI | InChI=1S/C23H20N2O5/c1-13(29-23(27)14-7-9-15(24)10-8-14)22(26)25-18-12-20-17(11-21(18)28-2)16-5-3-4-6-19(16)30-20/h3-13H,24H2,1-2H3,(H,25,26)/t13-/m1/s1 |
| InChIKey | SLPXBIFXCRSWSM-CYBMUJFWSA-N |
| XLogP | 4.36 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|