C28H28N2O6 — CID 5004378
[1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-benzamido-3-methylbutanoate (PubChem CID 5004378) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-benzamido-3-methylbutanoate.
| Compound Name | [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 5004378 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2-benzamido-3-methylbutanoate |
| SMILES | COc1cc2c(cc1NC(=O)C(C)OC(=O)C(NC(=O)c1ccccc1)C(C)C)oc1ccccc12 |
| InChI | InChI=1S/C28H28N2O6/c1-16(2)25(30-27(32)18-10-6-5-7-11-18)28(33)35-17(3)26(31)29-21-15-23-20(14-24(21)34-4)19-12-8-9-13-22(19)36-23/h5-17,25H,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | GCCFJGKQAHIFCI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |