C22H23NO5 — CID 7717571
[(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] cyclopentanecarboxylate (PubChem CID 7717571) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] cyclopentanecarboxylate.
| Compound Name | [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 7717571 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [(2S)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] cyclopentanecarboxylate |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)OC(=O)C1CCCC1)oc1ccccc12 |
| InChI | InChI=1S/C22H23NO5/c1-13(27-22(25)14-7-3-4-8-14)21(24)23-17-12-19-16(11-20(17)26-2)15-9-5-6-10-18(15)28-19/h5-6,9-14H,3-4,7-8H2,1-2H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | SGHUHIPORUUDEN-ZDUSSCGKSA-N |
| XLogP | 4.66 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |