C22H18FNO4 — CID 7815222
(2S)-2-(2-fluorophenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 7815222) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | (2S)-2-(2-fluorophenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 7815222 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2S)-2-(2-fluorophenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)Oc1ccccc1F)oc1ccccc12 |
| InChI | InChI=1S/C22H18FNO4/c1-13(27-19-10-6-4-8-16(19)23)22(25)24-17-12-20-15(11-21(17)26-2)14-7-3-5-9-18(14)28-20/h3-13H,1-2H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | DUEBFLBCHUJJRL-ZDUSSCGKSA-N |
| XLogP | 5.14 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |