C24H23NO4 — CID 18291295
2-(2,3-dimethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 18291295) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 18291295 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)C(C)Oc1cccc(C)c1C)oc1ccccc12 |
| InChI | InChI=1S/C24H23NO4/c1-14-8-7-11-20(15(14)2)28-16(3)24(26)25-19-13-22-18(12-23(19)27-4)17-9-5-6-10-21(17)29-22/h5-13,16H,1-4H3,(H,25,26) |
| InChIKey | DHTIOZPVNNYMSW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |