C24H23NO4 — CID 22831051
2-(3-ethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 22831051) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | 2-(3-ethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 22831051 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-(3-ethylphenoxy)-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | CCc1cccc(OC(C)C(=O)Nc2cc3oc4ccccc4c3cc2OC)c1 |
| InChI | InChI=1S/C24H23NO4/c1-4-16-8-7-9-17(12-16)28-15(2)24(26)25-20-14-22-19(13-23(20)27-3)18-10-5-6-11-21(18)29-22/h5-15H,4H2,1-3H3,(H,25,26) |
| InChIKey | NZCFATQGWXMIOB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |