C18H21ClN2O3 — CID 119674201
N-(2-methoxydibenzofuran-3-yl)-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119674201) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119674201 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cc2oc3ccccc3c2cc1OC.Cl |
| InChI | InChI=1S/C18H20N2O3.ClH/c1-11(10-19-2)18(21)20-14-9-16-13(8-17(14)22-3)12-6-4-5-7-15(12)23-16;/h4-9,11,19H,10H2,1-3H3,(H,20,21);1H |
| InChIKey | UHJFGHVJUGHUQL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |