C22H27N2O3+ — CID 2462122
(2R)-2-(azepan-1-ium-1-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 2462122) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is (2R)-2-(azepan-1-ium-1-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | (2R)-2-(azepan-1-ium-1-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 2462122 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R)-2-(azepan-1-ium-1-yl)-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@@H](C)[NH+]1CCCCCC1)oc1ccccc12 |
| InChI | InChI=1S/C22H26N2O3/c1-15(24-11-7-3-4-8-12-24)22(25)23-18-14-20-17(13-21(18)26-2)16-9-5-6-10-19(16)27-20/h5-6,9-10,13-15H,3-4,7-8,11-12H2,1-2H3,(H,23,25)/p+1/t15-/m1/s1 |
| InChIKey | XAERRZVTCOBAHM-OAHLLOKOSA-O |
| XLogP | 3.38 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |