C22H18FNO3S — CID 7484407
(2S)-2-(2-fluorophenyl)sulfanyl-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 7484407) has the molecular formula C22H18FNO3S and a molecular weight of 395.46 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenyl)sulfanyl-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | (2S)-2-(2-fluorophenyl)sulfanyl-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 7484407 |
| Molecular Formula | C22H18FNO3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-(2-fluorophenyl)sulfanyl-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)Sc1ccccc1F)oc1ccccc12 |
| InChI | InChI=1S/C22H18FNO3S/c1-13(28-21-10-6-4-8-16(21)23)22(25)24-17-12-19-15(11-20(17)26-2)14-7-3-5-9-18(14)27-19/h3-13H,1-2H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | WRDXZLLXUPQYBJ-ZDUSSCGKSA-N |
| XLogP | 5.85 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |