C21H24N2O3S2 — CID 8818565
[(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 8818565) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818565 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)C(=O)Nc1cc2oc3ccccc3c2cc1OC |
| InChI | InChI=1S/C21H24N2O3S2/c1-5-23(6-2)21(27)28-13(3)20(24)22-16-12-18-15(11-19(16)25-4)14-9-7-8-10-17(14)26-18/h7-13H,5-6H2,1-4H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | FDUJBZUVHWMVHG-CYBMUJFWSA-N |
| XLogP | 5.28 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|