C18H17N5O3S — CID 7365406
(2S)-N-(2-methoxydibenzofuran-3-yl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 7365406) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is (2S)-N-(2-methoxydibenzofuran-3-yl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(2-methoxydibenzofuran-3-yl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7365406 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2S)-N-(2-methoxydibenzofuran-3-yl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)Sc1nnnn1C)oc1ccccc12 |
| InChI | InChI=1S/C18H17N5O3S/c1-10(27-18-20-21-22-23(18)2)17(24)19-13-9-15-12(8-16(13)25-3)11-6-4-5-7-14(11)26-15/h4-10H,1-3H3,(H,19,24)/t10-/m0/s1 |
| InChIKey | RJATVLAPBSRTME-JTQLQIEISA-N |
| XLogP | 3.24 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |