C27H24N2O4S — CID 3926182
N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-methylquinolin-2-yl)sulfanylpropanamide (PubChem CID 3926182) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-methylquinolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-methylquinolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 3926182 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-methylquinolin-2-yl)sulfanylpropanamide |
| SMILES | COc1ccc2c(C)cc(SC(C)C(=O)Nc3cc4oc5ccccc5c4cc3OC)nc2c1 |
| InChI | InChI=1S/C27H24N2O4S/c1-15-11-26(28-21-12-17(31-3)9-10-18(15)21)34-16(2)27(30)29-22-14-24-20(13-25(22)32-4)19-7-5-6-8-23(19)33-24/h5-14,16H,1-4H3,(H,29,30) |
| InChIKey | AKVCYSOZUINOBV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |