C32H26N2O4S — CID 4679253
N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylpropanamide (PubChem CID 4679253) has the molecular formula C32H26N2O4S and a molecular weight of 534.64 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 4679253 |
| Molecular Formula | C32H26N2O4S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanylpropanamide |
| SMILES | COc1ccc2c(-c3ccccc3)cc(SC(C)C(=O)Nc3cc4oc5ccccc5c4cc3OC)nc2c1 |
| InChI | InChI=1S/C32H26N2O4S/c1-19(32(35)34-27-18-29-25(16-30(27)37-3)23-11-7-8-12-28(23)38-29)39-31-17-24(20-9-5-4-6-10-20)22-14-13-21(36-2)15-26(22)33-31/h4-19H,1-3H3,(H,34,35) |
| InChIKey | NDZJRJKVYGIHHF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |