C29H29N3O3S — CID 25349930
(2R)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 25349930) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is (2R)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 25349930 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (2R)-2-(7-methoxy-4-phenylquinolin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | COc1ccc2c(-c3ccccc3)cc(S[C@H](C)C(=O)Nc3ccc(N4CCOCC4)cc3)nc2c1 |
| InChI | InChI=1S/C29H29N3O3S/c1-20(29(33)30-22-8-10-23(11-9-22)32-14-16-35-17-15-32)36-28-19-26(21-6-4-3-5-7-21)25-13-12-24(34-2)18-27(25)31-28/h3-13,18-20H,14-17H2,1-2H3,(H,30,33)/t20-/m1/s1 |
| InChIKey | KJLRUJZXIKPSDZ-HXUWFJFHSA-N |
| XLogP | 5.87 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|