C19H22N2O2S — CID 2079704
(2R)-N-(4-morpholin-4-ylphenyl)-2-phenylsulfanylpropanamide (PubChem CID 2079704) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (2R)-N-(4-morpholin-4-ylphenyl)-2-phenylsulfanylpropanamide.
| Compound Name | (2R)-N-(4-morpholin-4-ylphenyl)-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2079704 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2R)-N-(4-morpholin-4-ylphenyl)-2-phenylsulfanylpropanamide |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-15(24-18-5-3-2-4-6-18)19(22)20-16-7-9-17(10-8-16)21-11-13-23-14-12-21/h2-10,15H,11-14H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | QNNPHTUGTYCISY-OAHLLOKOSA-N |
| XLogP | 3.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|