C26H32N6O2S — CID 40966971
(2S)-N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 40966971) has the molecular formula C26H32N6O2S and a molecular weight of 492.65 g/mol. Its IUPAC name is (2S)-N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 40966971 |
| Molecular Formula | C26H32N6O2S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (2S)-N-(4-morpholin-4-ylphenyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nnc(N2CCCCC2)n1-c1ccccc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H32N6O2S/c1-20(24(33)27-21-10-12-22(13-11-21)30-16-18-34-19-17-30)35-26-29-28-25(31-14-6-3-7-15-31)32(26)23-8-4-2-5-9-23/h2,4-5,8-13,20H,3,6-7,14-19H2,1H3,(H,27,33)/t20-/m0/s1 |
| InChIKey | IIWHIQQBGRFRHU-FQEVSTJZSA-N |
| XLogP | 4.21 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|