C23H26N4O2S — CID 25339313
(2S)-2-(1-benzylimidazol-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 25339313) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is (2S)-2-(1-benzylimidazol-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-(1-benzylimidazol-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 25339313 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2S)-2-(1-benzylimidazol-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | C[C@H](Sc1nccn1Cc1ccccc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-18(30-23-24-11-12-27(23)17-19-5-3-2-4-6-19)22(28)25-20-7-9-21(10-8-20)26-13-15-29-16-14-26/h2-12,18H,13-17H2,1H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | BCQBLRRNMXAPEI-SFHVURJKSA-N |
| XLogP | 3.89 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|