C22H24FN5O2S — CID 41001194
(2S)-2-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 41001194) has the molecular formula C22H24FN5O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is (2S)-2-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 41001194 |
| Molecular Formula | C22H24FN5O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (2S)-2-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | C[C@H](Sc1nnc(-c2ccccc2F)n1C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H24FN5O2S/c1-15(31-22-26-25-20(27(22)2)18-5-3-4-6-19(18)23)21(29)24-16-7-9-17(10-8-16)28-11-13-30-14-12-28/h3-10,15H,11-14H2,1-2H3,(H,24,29)/t15-/m0/s1 |
| InChIKey | YVZOVIYXBQDRIU-HNNXBMFYSA-N |
| XLogP | 3.58 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|