C24H25N5O2S — CID 2078517
(2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 2078517) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 2078517 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1cc2nnc(S[C@H](C)C(=O)Nc3ccc(N4CCOCC4)cc3)n2c2ccccc12 |
| InChI | InChI=1S/C24H25N5O2S/c1-16-15-22-26-27-24(29(22)21-6-4-3-5-20(16)21)32-17(2)23(30)25-18-7-9-19(10-8-18)28-11-13-31-14-12-28/h3-10,15,17H,11-14H2,1-2H3,(H,25,30)/t17-/m1/s1 |
| InChIKey | DZDRZAUBTBEOBV-QGZVFWFLSA-N |
| XLogP | 4.15 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|