C20H15Cl3N4OS — CID 2390189
(2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2390189) has the molecular formula C20H15Cl3N4OS and a molecular weight of 465.79 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2390189 |
| Molecular Formula | C20H15Cl3N4OS |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | Cc1cc2nnc(S[C@H](C)C(=O)Nc3cc(Cl)c(Cl)cc3Cl)n2c2ccccc12 |
| InChI | InChI=1S/C20H15Cl3N4OS/c1-10-7-18-25-26-20(27(18)17-6-4-3-5-12(10)17)29-11(2)19(28)24-16-9-14(22)13(21)8-15(16)23/h3-9,11H,1-2H3,(H,24,28)/t11-/m1/s1 |
| InChIKey | WRSFHZANBQTXTA-LLVKDONJSA-N |
| XLogP | 6.27 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|