C21H16F3N5O3S — CID 41040938
(2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 41040938) has the molecular formula C21H16F3N5O3S and a molecular weight of 475.45 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 41040938 |
| Molecular Formula | C21H16F3N5O3S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (2R)-2-[(5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1cc2nnc(S[C@H](C)C(=O)Nc3ccc([N+](=O)[O-])cc3C(F)(F)F)n2c2ccccc12 |
| InChI | InChI=1S/C21H16F3N5O3S/c1-11-9-18-26-27-20(28(18)17-6-4-3-5-14(11)17)33-12(2)19(30)25-16-8-7-13(29(31)32)10-15(16)21(22,23)24/h3-10,12H,1-2H3,(H,25,30)/t12-/m1/s1 |
| InChIKey | GHUFRIVIUBEMLI-GFCCVEGCSA-N |
| XLogP | 5.24 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|